C27H35F6NO10S4 — CID 140753260
[5-(4-diethylsulfoniophenoxy)carbonyl-2-adamantyl]oxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-propan-2-yloxysulfonylpropyl)sulfonylazanide (PubChem CID 140753260) has the molecular formula C27H35F6NO10S4 and a molecular weight of 775.83 g/mol. Its IUPAC name is [5-(4-diethylsulfoniophenoxy)carbonyl-2-adamantyl]oxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-propan-2-yloxysulfonylpropyl)sulfonylazanide.
| Compound Name | [5-(4-diethylsulfoniophenoxy)carbonyl-2-adamantyl]oxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-propan-2-yloxysulfonylpropyl)sulfonylazanide |
|---|---|
| PubChem CID | 140753260 |
| Molecular Formula | C27H35F6NO10S4 |
| Molecular Weight | 775.83 g/mol |
| Exact Mass | 775.10 |
| IUPAC Name | [5-(4-diethylsulfoniophenoxy)carbonyl-2-adamantyl]oxysulfonyl-(1,1,2,2,3,3-hexafluoro-3-propan-2-yloxysulfonylpropyl)sulfonylazanide |
| SMILES | CC[S+](CC)c1ccc(OC(=O)C23CC4CC(C2)C(OS(=O)(=O)[N-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)OC(C)C)C(C4)C3)cc1 |
| InChI | InChI=1S/C27H35F6NO10S4/c1-5-45(6-2)21-9-7-20(8-10-21)42-23(35)24-13-17-11-18(14-24)22(19(12-17)15-24)44-48(40,41)34-46(36,37)26(30,31)25(28,29)27(32,33)47(38,39)43-16(3)4/h7-10,16-19,22H,5-6,11-15H2,1-4H3 |
| InChIKey | QTEWHNLWFDQSAQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 161.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.83 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|