C31H30F2O6S2 — CID 154594486
2-[4-(4-diphenylsulfoniophenoxy)adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonate (PubChem CID 154594486) has the molecular formula C31H30F2O6S2 and a molecular weight of 600.71 g/mol. Its IUPAC name is 2-[4-(4-diphenylsulfoniophenoxy)adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonate.
| Compound Name | 2-[4-(4-diphenylsulfoniophenoxy)adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonate |
|---|---|
| PubChem CID | 154594486 |
| Molecular Formula | C31H30F2O6S2 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 2-[4-(4-diphenylsulfoniophenoxy)adamantane-1-carbonyl]oxy-1,1-difluoroethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])C12CC3CC(C1)C(Oc1ccc([S+](c4ccccc4)c4ccccc4)cc1)C(C3)C2 |
| InChI | InChI=1S/C31H30F2O6S2/c32-31(33,41(35,36)37)20-38-29(34)30-17-21-15-22(18-30)28(23(16-21)19-30)39-24-11-13-27(14-12-24)40(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,21-23,28H,15-20H2 |
| InChIKey | SUXUEGQNPSUTFT-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|