C8H10F5NO3 — CID 140765998
[1-[(2R)-4,4-difluoropyrrolidin-2-yl]-1-hydroxyethyl] 2,2,2-trifluoroacetate (PubChem CID 140765998) has the molecular formula C8H10F5NO3 and a molecular weight of 263.16 g/mol. Its IUPAC name is [1-[(2R)-4,4-difluoropyrrolidin-2-yl]-1-hydroxyethyl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[(2R)-4,4-difluoropyrrolidin-2-yl]-1-hydroxyethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140765998 |
| Molecular Formula | C8H10F5NO3 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [1-[(2R)-4,4-difluoropyrrolidin-2-yl]-1-hydroxyethyl] 2,2,2-trifluoroacetate |
| SMILES | CC(O)(OC(=O)C(F)(F)F)[C@H]1CC(F)(F)CN1 |
| InChI | InChI=1S/C8H10F5NO3/c1-6(16,17-5(15)8(11,12)13)4-2-7(9,10)3-14-4/h4,14,16H,2-3H2,1H3/t4-,6?/m1/s1 |
| InChIKey | GTCCBRKOQNQBBU-NJXYFUOMSA-N |
| XLogP | 0.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|