C25H30ClN5O4 — CID 140775754
N-(2-chloroethyl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(2-methyl-4-morpholin-4-ylphenyl)triazole-4-carboxamide (PubChem CID 140775754) has the molecular formula C25H30ClN5O4 and a molecular weight of 500.00 g/mol. Its IUPAC name is N-(2-chloroethyl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(2-methyl-4-morpholin-4-ylphenyl)triazole-4-carboxamide.
| Compound Name | N-(2-chloroethyl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(2-methyl-4-morpholin-4-ylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 140775754 |
| Molecular Formula | C25H30ClN5O4 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | N-(2-chloroethyl)-1-(2,4-dihydroxy-5-propan-2-ylphenyl)-5-(2-methyl-4-morpholin-4-ylphenyl)triazole-4-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)ccc1-c1c(C(=O)NCCCl)nnn1-c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C25H30ClN5O4/c1-15(2)19-13-20(22(33)14-21(19)32)31-24(23(28-29-31)25(34)27-7-6-26)18-5-4-17(12-16(18)3)30-8-10-35-11-9-30/h4-5,12-15,32-33H,6-11H2,1-3H3,(H,27,34) |
| InChIKey | WGTKJGCMJDAGDT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|