C14H13BN4O7 — CID 140778405
(3R)-2-hydroxy-3-[[2-(4-nitropyrazol-1-yl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 140778405) has the molecular formula C14H13BN4O7 and a molecular weight of 360.09 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[[2-(4-nitropyrazol-1-yl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[[2-(4-nitropyrazol-1-yl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 140778405 |
| Molecular Formula | C14H13BN4O7 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (3R)-2-hydroxy-3-[[2-(4-nitropyrazol-1-yl)acetyl]amino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C14H13BN4O7/c20-12(7-18-6-9(5-16-18)19(24)25)17-11-4-8-2-1-3-10(14(21)22)13(8)26-15(11)23/h1-3,5-6,11,23H,4,7H2,(H,17,20)(H,21,22)/t11-/m0/s1 |
| InChIKey | VLWLPYICUKWURH-NSHDSACASA-N |
| XLogP | -0.37 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|