C15H16BFO6 — CID 140830501
butanoyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate (PubChem CID 140830501) has the molecular formula C15H16BFO6 and a molecular weight of 322.10 g/mol. Its IUPAC name is butanoyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate.
| Compound Name | butanoyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate |
|---|---|
| PubChem CID | 140830501 |
| Molecular Formula | C15H16BFO6 |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | butanoyloxymethyl (1aR,7bS)-5-fluoro-2-hydroxy-1a,7b-dihydro-1H-cyclopropa[c][1,2]benzoxaborinine-4-carboxylate |
| SMILES | CCCC(=O)OCOC(=O)c1c(F)ccc2c1OB(O)[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C15H16BFO6/c1-2-3-12(18)21-7-22-15(19)13-11(17)5-4-8-9-6-10(9)16(20)23-14(8)13/h4-5,9-10,20H,2-3,6-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | JWBQTPLOXGAFTF-NXEZZACHSA-N |
| XLogP | 2.01 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|