About bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide)
bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) (PubChem CID 140839971) has the molecular formula C18H42MoN4
and a molecular weight of 410.50 g/mol. Its IUPAC name is bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide).
Molecular Properties
| Compound Name | bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) |
| PubChem CID | 140839971 |
| Molecular Formula | C18H42MoN4 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) |
| SMILES | CC(C)(C)N=[Mo+2]=NC(C)(C)C.C[N-]CC(C)C.C[N-]CC(C)C |
| InChI | InChI=1S/2C5H12N.2C4H9N.Mo/c2*1-5(2)4-6-3;2*1-4(2,3)5;/h2*5H,4H2,1-3H3;2*1-3H3;/q2*-1;;;+2 |
| InChIKey | BPIJHPKMCHFRKU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide)?
The IUPAC name of bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) (CID 140839971) is bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide).
What is the SMILES notation for bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide)?
The canonical SMILES for bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) is CC(C)(C)N=[Mo+2]=NC(C)(C)C.C[N-]CC(C)C.C[N-]CC(C)C.
What is the InChIKey of bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide)?
The InChIKey is BPIJHPKMCHFRKU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12N.2C4H9N.Mo/c2*1-5(2)4-6-3;2*1-4(2,3)5;/h2*5H,4H2,1-3H3;2*1-3H3;/q2*-1;;;+2.
What are the key properties of bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide)?
bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) has a molecular weight of 410.50 g/mol, XLogP of 6.32, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tert-butylimino)molybdenum(2+);bis(methyl(2-methylpropyl)azanide) is sourced from PubChem (CID 140839971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).