C24H27ClN4OSi — CID 140863556
2-[tert-butyl(diphenyl)silyl]oxy-2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)ethanamine (PubChem CID 140863556) has the molecular formula C24H27ClN4OSi and a molecular weight of 451.05 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)ethanamine.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)ethanamine |
|---|---|
| PubChem CID | 140863556 |
| Molecular Formula | C24H27ClN4OSi |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-2-(6-chloroimidazo[1,2-b]pyridazin-2-yl)ethanamine |
| SMILES | CC(C)(C)[Si](OC(CN)c1cn2nc(Cl)ccc2n1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27ClN4OSi/c1-24(2,3)31(18-10-6-4-7-11-18,19-12-8-5-9-13-19)30-21(16-26)20-17-29-23(27-20)15-14-22(25)28-29/h4-15,17,21H,16,26H2,1-3H3 |
| InChIKey | SBOLVKYIQLWTOQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|