C25H27Cl2N3OSi — CID 164524948
tert-butyl-[(2S)-2-(4,6-dichloropyrazolo[4,3-c]pyridin-2-yl)propoxy]-diphenylsilane (PubChem CID 164524948) has the molecular formula C25H27Cl2N3OSi and a molecular weight of 484.50 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-(4,6-dichloropyrazolo[4,3-c]pyridin-2-yl)propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S)-2-(4,6-dichloropyrazolo[4,3-c]pyridin-2-yl)propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164524948 |
| Molecular Formula | C25H27Cl2N3OSi |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | tert-butyl-[(2S)-2-(4,6-dichloropyrazolo[4,3-c]pyridin-2-yl)propoxy]-diphenylsilane |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)n1cc2c(Cl)nc(Cl)cc2n1 |
| InChI | InChI=1S/C25H27Cl2N3OSi/c1-18(30-16-21-22(29-30)15-23(26)28-24(21)27)17-31-32(25(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-16,18H,17H2,1-4H3/t18-/m0/s1 |
| InChIKey | KFHVDHRUKKNVCE-SFHVURJKSA-N |
| XLogP | 5.88 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|