C24H26Cl2N2O3Si — CID 175552818
2-[tert-butyl(diphenyl)silyl]oxy-3-(3,6-dichloro-5-methylpyridazin-4-yl)propanoic acid (PubChem CID 175552818) has the molecular formula C24H26Cl2N2O3Si and a molecular weight of 489.48 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-3-(3,6-dichloro-5-methylpyridazin-4-yl)propanoic acid.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-3-(3,6-dichloro-5-methylpyridazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 175552818 |
| Molecular Formula | C24H26Cl2N2O3Si |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-3-(3,6-dichloro-5-methylpyridazin-4-yl)propanoic acid |
| SMILES | Cc1c(Cl)nnc(Cl)c1CC(O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H26Cl2N2O3Si/c1-16-19(22(26)28-27-21(16)25)15-20(23(29)30)31-32(24(2,3)4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,20H,15H2,1-4H3,(H,29,30) |
| InChIKey | VNCZQZMXTRLZDW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|