C9H7NO2 — CID 140863830
2-(2,2-dideuterio-1,3-benzodioxol-5-yl)acetonitrile (PubChem CID 140863830) has the molecular formula C9H7NO2 and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-(2,2-dideuterio-1,3-benzodioxol-5-yl)acetonitrile.
| Compound Name | 2-(2,2-dideuterio-1,3-benzodioxol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 140863830 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-(2,2-dideuterio-1,3-benzodioxol-5-yl)acetonitrile |
| SMILES | [2H]C1([2H])Oc2ccc(CC#N)cc2O1 |
| InChI | InChI=1S/C9H7NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3,6H2/i6D2 |
| InChIKey | ZQPBOYASBNAXOZ-NCYHJHSESA-N |
| XLogP | 1.48 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |