C16H21BrN4O3 — CID 140869598
tert-butyl 3-[(5-bromo-3-methoxyindazol-2-yl)amino]azetidine-1-carboxylate (PubChem CID 140869598) has the molecular formula C16H21BrN4O3 and a molecular weight of 397.27 g/mol. Its IUPAC name is tert-butyl 3-[(5-bromo-3-methoxyindazol-2-yl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(5-bromo-3-methoxyindazol-2-yl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 140869598 |
| Molecular Formula | C16H21BrN4O3 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | tert-butyl 3-[(5-bromo-3-methoxyindazol-2-yl)amino]azetidine-1-carboxylate |
| SMILES | COc1c2cc(Br)ccc2nn1NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H21BrN4O3/c1-16(2,3)24-15(22)20-8-11(9-20)18-21-14(23-4)12-7-10(17)5-6-13(12)19-21/h5-7,11,18H,8-9H2,1-4H3 |
| InChIKey | PFGPRCRPFXVXIC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |