C17H21BN2O5 — CID 140882901
7-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,1'-cyclobutane]-2-one (PubChem CID 140882901) has the molecular formula C17H21BN2O5 and a molecular weight of 344.18 g/mol. Its IUPAC name is 7-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,1'-cyclobutane]-2-one.
| Compound Name | 7-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,1'-cyclobutane]-2-one |
|---|---|
| PubChem CID | 140882901 |
| Molecular Formula | C17H21BN2O5 |
| Molecular Weight | 344.18 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 7-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1H-indole-3,1'-cyclobutane]-2-one |
| SMILES | CC1(C)OB(c2cc([N+](=O)[O-])c3c(c2)C2(CCC2)C(=O)N3)OC1(C)C |
| InChI | InChI=1S/C17H21BN2O5/c1-15(2)16(3,4)25-18(24-15)10-8-11-13(12(9-10)20(22)23)19-14(21)17(11)6-5-7-17/h8-9H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | SBKDEJGXYSBDFZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|