C13H14N2O3 — CID 135124158
7-methyl-5-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one (PubChem CID 135124158) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 7-methyl-5-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one.
| Compound Name | 7-methyl-5-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 135124158 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 7-methyl-5-nitrospiro[1H-indole-3,1'-cyclopentane]-2-one |
| SMILES | Cc1cc([N+](=O)[O-])cc2c1NC(=O)C21CCCC1 |
| InChI | InChI=1S/C13H14N2O3/c1-8-6-9(15(17)18)7-10-11(8)14-12(16)13(10)4-2-3-5-13/h6-7H,2-5H2,1H3,(H,14,16) |
| InChIKey | IOQPGODHKHYTED-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|