C25H28BrNO3 — CID 140902095
methyl (E)-3-[3-[(4-bromophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]-2-methylprop-2-enoate (PubChem CID 140902095) has the molecular formula C25H28BrNO3 and a molecular weight of 470.41 g/mol. Its IUPAC name is methyl (E)-3-[3-[(4-bromophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]-2-methylprop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(4-bromophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140902095 |
| Molecular Formula | C25H28BrNO3 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl (E)-3-[3-[(4-bromophenyl)methyl-(cyclohexanecarbonyl)amino]phenyl]-2-methylprop-2-enoate |
| SMILES | COC(=O)/C(C)=C/c1cccc(N(Cc2ccc(Br)cc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H28BrNO3/c1-18(25(29)30-2)15-20-7-6-10-23(16-20)27(17-19-11-13-22(26)14-12-19)24(28)21-8-4-3-5-9-21/h6-7,10-16,21H,3-5,8-9,17H2,1-2H3/b18-15+ |
| InChIKey | OXXREKLRUISORP-OBGWFSINSA-N |
| XLogP | 6.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|