C18H19N2+ — CID 140917849
8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3-(trideuteriomethyl)quinoline (PubChem CID 140917849) has the molecular formula C18H19N2+ and a molecular weight of 269.40 g/mol. Its IUPAC name is 8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3-(trideuteriomethyl)quinoline.
| Compound Name | 8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3-(trideuteriomethyl)quinoline |
|---|---|
| PubChem CID | 140917849 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 8-methyl-7-[1-methyl-5-(trideuteriomethyl)pyridin-1-ium-2-yl]-3-(trideuteriomethyl)quinoline |
| SMILES | [2H]C([2H])([2H])c1cnc2c(C)c(-c3ccc(C([2H])([2H])[2H])c[n+]3C)ccc2c1 |
| InChI | InChI=1S/C18H19N2/c1-12-5-8-17(20(4)11-12)16-7-6-15-9-13(2)10-19-18(15)14(16)3/h5-11H,1-4H3/q+1/i1D3,2D3 |
| InChIKey | KOHVNDOXWZHWLT-WFGJKAKNSA-N |
| XLogP | 3.65 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|