C27H39Cl2NO3 — CID 140928291
[(8S,9S,14S,17S)-17-[(2-methylpropan-2-yl)oxy]-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl] N-(2-chloroethyl)-N-(3-chloropropyl)carbamate (PubChem CID 140928291) has the molecular formula C27H39Cl2NO3 and a molecular weight of 496.52 g/mol. Its IUPAC name is [(8S,9S,14S,17S)-17-[(2-methylpropan-2-yl)oxy]-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl] N-(2-chloroethyl)-N-(3-chloropropyl)carbamate.
| Compound Name | [(8S,9S,14S,17S)-17-[(2-methylpropan-2-yl)oxy]-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl] N-(2-chloroethyl)-N-(3-chloropropyl)carbamate |
|---|---|
| PubChem CID | 140928291 |
| Molecular Formula | C27H39Cl2NO3 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [(8S,9S,14S,17S)-17-[(2-methylpropan-2-yl)oxy]-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl] N-(2-chloroethyl)-N-(3-chloropropyl)carbamate |
| SMILES | CC(C)(C)O[C@H]1CC[C@@H]2C1CC[C@@H]1c3ccc(OC(=O)N(CCCl)CCCCl)cc3CC[C@H]12 |
| InChI | InChI=1S/C27H39Cl2NO3/c1-27(2,3)33-25-12-11-23-22-7-5-18-17-19(6-8-20(18)21(22)9-10-24(23)25)32-26(31)30(16-14-29)15-4-13-28/h6,8,17,21-25H,4-5,7,9-16H2,1-3H3/t21-,22-,23+,24?,25+/m1/s1 |
| InChIKey | NYCZLDOCMBJFQN-UDLXLPFGSA-N |
| XLogP | 7.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|