C12H15N5O3 — CID 140934808
(2S,5R)-6-hydroxy-7-oxo-N-pyridin-3-yl-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide (PubChem CID 140934808) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N-pyridin-3-yl-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N-pyridin-3-yl-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
|---|---|
| PubChem CID | 140934808 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N-pyridin-3-yl-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
| SMILES | NN(C(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O)c1cccnc1 |
| InChI | InChI=1S/C12H15N5O3/c13-16(8-2-1-5-14-6-8)11(18)10-4-3-9-7-15(10)12(19)17(9)20/h1-2,5-6,9-10,20H,3-4,7,13H2/t9-,10+/m1/s1 |
| InChIKey | VMAWFSDGGQHHLL-ZJUUUORDSA-N |
| XLogP | -0.05 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|