C18H19Cl2N3O3Pt — CID 140936592
dichloroplatinum;2-[(9-oxophenalen-1-yl)amino]ethyl 2,3-diaminopropanoate (PubChem CID 140936592) has the molecular formula C18H19Cl2N3O3Pt and a molecular weight of 591.35 g/mol. Its IUPAC name is dichloroplatinum;2-[(9-oxophenalen-1-yl)amino]ethyl 2,3-diaminopropanoate.
| Compound Name | dichloroplatinum;2-[(9-oxophenalen-1-yl)amino]ethyl 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 140936592 |
| Molecular Formula | C18H19Cl2N3O3Pt |
| Molecular Weight | 591.35 g/mol |
| Exact Mass | 590.05 |
| IUPAC Name | dichloroplatinum;2-[(9-oxophenalen-1-yl)amino]ethyl 2,3-diaminopropanoate |
| SMILES | Cl[Pt]Cl.NCC(N)C(=O)OCCNc1ccc2cccc3c2c1C(=O)C=C3 |
| InChI | InChI=1S/C18H19N3O3.2ClH.Pt/c19-10-13(20)18(23)24-9-8-21-14-6-4-11-2-1-3-12-5-7-15(22)17(14)16(11)12;;;/h1-7,13,21H,8-10,19-20H2;2*1H;/q;;;+2/p-2 |
| InChIKey | SYVDFRMEOIGDKC-UHFFFAOYSA-L |
| XLogP | 2.67 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|