About 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-)
9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) (PubChem CID 11556750) has the molecular formula C29H44Cl3NO2Pt
and a molecular weight of 740.11 g/mol. Its IUPAC name is 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-).
Molecular Properties
| Compound Name | 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) |
| PubChem CID | 11556750 |
| Molecular Formula | C29H44Cl3NO2Pt |
| Molecular Weight | 740.11 g/mol |
| Exact Mass | 738.21 |
| IUPAC Name | 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cl[Pt-](Cl)Cl.O=C1C=Cc2cccc3ccc(O)c1c23 |
| InChI | InChI=1S/C16H36N.C13H8O2.3ClH.Pt/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;14-10-6-4-8-2-1-3-9-5-7-11(15)13(10)12(8)9;;;;/h5-16H2,1-4H3;1-7,14H;3*1H;/q+1;;;;;+2/p-3 |
| InChIKey | RPVAIEOWTSXSDT-UHFFFAOYSA-K |
| XLogP | 9.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 740.11 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-)?
The IUPAC name of 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) (CID 11556750) is 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-).
What is the SMILES notation for 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-)?
The canonical SMILES for 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) is CCCC[N+](CCCC)(CCCC)CCCC.Cl[Pt-](Cl)Cl.O=C1C=Cc2cccc3ccc(O)c1c23.
What is the InChIKey of 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-)?
The InChIKey is RPVAIEOWTSXSDT-UHFFFAOYSA-K. The full InChI is InChI=1S/C16H36N.C13H8O2.3ClH.Pt/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;14-10-6-4-8-2-1-3-9-5-7-11(15)13(10)12(8)9;;;;/h5-16H2,1-4H3;1-7,14H;3*1H;/q+1;;;;;+2/p-3.
What are the key properties of 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-)?
9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) has a molecular weight of 740.11 g/mol, XLogP of 9.82, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxyphenalen-1-one;tetrabutylazanium;trichloroplatinum(1-) is sourced from PubChem (CID 11556750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).