C39H52NO5+ — CID 87158815
2-methylpentacene-1,11,12,13,14-pentol;tetrabutylazanium (PubChem CID 87158815) has the molecular formula C39H52NO5+ and a molecular weight of 614.85 g/mol. Its IUPAC name is 2-methylpentacene-1,11,12,13,14-pentol;tetrabutylazanium.
| Compound Name | 2-methylpentacene-1,11,12,13,14-pentol;tetrabutylazanium |
|---|---|
| PubChem CID | 87158815 |
| Molecular Formula | C39H52NO5+ |
| Molecular Weight | 614.85 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | 2-methylpentacene-1,11,12,13,14-pentol;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1ccc2cc3cc4cc5cccc(O)c5c(O)c4c(O)c3c(O)c2c1O |
| InChI | InChI=1S/C23H16O5.C16H36N/c1-10-5-6-12-8-14-9-13-7-11-3-2-4-15(24)16(11)21(26)18(13)23(28)19(14)22(27)17(12)20(10)25;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h2-9,24-28H,1H3;5-16H2,1-4H3/q;+1 |
| InChIKey | DXSSDNMXKCEYHC-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.85 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|