C17H38N2O9P2 — CID 140939705
N-[bis(diethoxyphosphoryl)methyl]-4-[bis(2-hydroxyethyl)amino]butanamide (PubChem CID 140939705) has the molecular formula C17H38N2O9P2 and a molecular weight of 476.44 g/mol. Its IUPAC name is N-[bis(diethoxyphosphoryl)methyl]-4-[bis(2-hydroxyethyl)amino]butanamide.
| Compound Name | N-[bis(diethoxyphosphoryl)methyl]-4-[bis(2-hydroxyethyl)amino]butanamide |
|---|---|
| PubChem CID | 140939705 |
| Molecular Formula | C17H38N2O9P2 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[bis(diethoxyphosphoryl)methyl]-4-[bis(2-hydroxyethyl)amino]butanamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)CCCN(CCO)CCO)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H38N2O9P2/c1-5-25-29(23,26-6-2)17(30(24,27-7-3)28-8-4)18-16(22)10-9-11-19(12-14-20)13-15-21/h17,20-21H,5-15H2,1-4H3,(H,18,22) |
| InChIKey | HTHXMFAOJQMWFN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|