C30H34N2 — CID 140940635
(2S)-1-(3,4b,8a-trimethyl-5,6,7,8-tetrahydrobenzo[h]triphenylen-4-yl)-2,3-dimethyl-2H-imidazole (PubChem CID 140940635) has the molecular formula C30H34N2 and a molecular weight of 422.62 g/mol. Its IUPAC name is (2S)-1-(3,4b,8a-trimethyl-5,6,7,8-tetrahydrobenzo[h]triphenylen-4-yl)-2,3-dimethyl-2H-imidazole.
| Compound Name | (2S)-1-(3,4b,8a-trimethyl-5,6,7,8-tetrahydrobenzo[h]triphenylen-4-yl)-2,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 140940635 |
| Molecular Formula | C30H34N2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (2S)-1-(3,4b,8a-trimethyl-5,6,7,8-tetrahydrobenzo[h]triphenylen-4-yl)-2,3-dimethyl-2H-imidazole |
| SMILES | Cc1ccc2c(c1N1C=CN(C)[C@@H]1C)C1(C)CCCCC1(C)c1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C30H34N2/c1-20-12-13-24-25-18-22-10-6-7-11-23(22)19-26(25)29(3)14-8-9-15-30(29,4)27(24)28(20)32-17-16-31(5)21(32)2/h6-7,10-13,16-19,21H,8-9,14-15H2,1-5H3/t21-,29?,30?/m0/s1 |
| InChIKey | ARRCHROSWIBJFA-KCOBHRJASA-N |
| XLogP | 7.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |