C20H22N2O — CID 134191832
(2S)-1-(9,9-dimethylxanthen-3-yl)-2,3-dimethyl-2H-imidazole (PubChem CID 134191832) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-1-(9,9-dimethylxanthen-3-yl)-2,3-dimethyl-2H-imidazole.
| Compound Name | (2S)-1-(9,9-dimethylxanthen-3-yl)-2,3-dimethyl-2H-imidazole |
|---|---|
| PubChem CID | 134191832 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2S)-1-(9,9-dimethylxanthen-3-yl)-2,3-dimethyl-2H-imidazole |
| SMILES | C[C@H]1N(C)C=CN1c1ccc2c(c1)Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C20H22N2O/c1-14-21(4)11-12-22(14)15-9-10-17-19(13-15)23-18-8-6-5-7-16(18)20(17,2)3/h5-14H,1-4H3/t14-/m0/s1 |
| InChIKey | AORAKYOMXVRAPP-AWEZNQCLSA-N |
| XLogP | 4.69 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |