C21H24N2O — CID 134191883
(2S)-1,2-dimethyl-3-(2,9,9-trimethylxanthen-3-yl)-2H-imidazole (PubChem CID 134191883) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-3-(2,9,9-trimethylxanthen-3-yl)-2H-imidazole.
| Compound Name | (2S)-1,2-dimethyl-3-(2,9,9-trimethylxanthen-3-yl)-2H-imidazole |
|---|---|
| PubChem CID | 134191883 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (2S)-1,2-dimethyl-3-(2,9,9-trimethylxanthen-3-yl)-2H-imidazole |
| SMILES | Cc1cc2c(cc1N1C=CN(C)[C@@H]1C)Oc1ccccc1C2(C)C |
| InChI | InChI=1S/C21H24N2O/c1-14-12-17-20(13-18(14)23-11-10-22(5)15(23)2)24-19-9-7-6-8-16(19)21(17,3)4/h6-13,15H,1-5H3/t15-/m0/s1 |
| InChIKey | KHTIMJKTVCAMEE-HNNXBMFYSA-N |
| XLogP | 5.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |