C26H32N2O — CID 176822731
(2S)-1,2-dimethyl-3-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)-2H-imidazole (PubChem CID 176822731) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is (2S)-1,2-dimethyl-3-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)-2H-imidazole.
| Compound Name | (2S)-1,2-dimethyl-3-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)-2H-imidazole |
|---|---|
| PubChem CID | 176822731 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (2S)-1,2-dimethyl-3-(1,1,4,4,9-pentamethyl-2,3-dihydronaphtho[2,1-b][1]benzofuran-8-yl)-2H-imidazole |
| SMILES | Cc1ccc2c(oc3ccc4c(c32)C(C)(C)CCC4(C)C)c1N1C=CN(C)[C@@H]1C |
| InChI | InChI=1S/C26H32N2O/c1-16-8-9-18-21-20(29-24(18)23(16)28-15-14-27(7)17(28)2)11-10-19-22(21)26(5,6)13-12-25(19,3)4/h8-11,14-15,17H,12-13H2,1-7H3/t17-/m0/s1 |
| InChIKey | RHVLJRRVEHPTQL-KRWDZBQOSA-N |
| XLogP | 6.81 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |