C11H14N4 — CID 140944597
2-methyl-N-propylpyrido[3,2-d]pyrimidin-4-amine (PubChem CID 140944597) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-methyl-N-propylpyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-propylpyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 140944597 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methyl-N-propylpyrido[3,2-d]pyrimidin-4-amine |
| SMILES | CCCNc1nc(C)nc2cccnc12 |
| InChI | InChI=1S/C11H14N4/c1-3-6-13-11-10-9(5-4-7-12-10)14-8(2)15-11/h4-5,7H,3,6H2,1-2H3,(H,13,14,15) |
| InChIKey | CIZBJESHPBYVMA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |