C18H18O8 — CID 140957767
[3,6,7-tris(hydroxymethoxy)anthracen-2-yl]oxymethanol (PubChem CID 140957767) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is [3,6,7-tris(hydroxymethoxy)anthracen-2-yl]oxymethanol.
| Compound Name | [3,6,7-tris(hydroxymethoxy)anthracen-2-yl]oxymethanol |
|---|---|
| PubChem CID | 140957767 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [3,6,7-tris(hydroxymethoxy)anthracen-2-yl]oxymethanol |
| SMILES | OCOc1cc2cc3cc(OCO)c(OCO)cc3cc2cc1OCO |
| InChI | InChI=1S/C18H18O8/c19-7-23-15-3-11-1-12-4-16(24-8-20)18(26-10-22)6-14(12)2-13(11)5-17(15)25-9-21/h1-6,19-22H,7-10H2 |
| InChIKey | MZIJWSXQRGSYLD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|