C28H37F13O9S — CID 140957939
1-O-[2-hydroxy-3-[2-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 140957939) has the molecular formula C28H37F13O9S and a molecular weight of 796.64 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[2-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2,2-dimethylpentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 140957939 |
| Molecular Formula | C28H37F13O9S |
| Molecular Weight | 796.64 g/mol |
| Exact Mass | 796.20 |
| IUPAC Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2,2-dimethyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCC(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)(C)C(=O)OC)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H37F13O9S/c1-7-15(10-21(2,3)20(46)50-12-16(42)11-49-17(43)13-51-14-22(4,5)19(45)47-6)18(44)48-9-8-23(29,30)24(31,32)25(33,34)26(35,36)27(37,38)28(39,40)41/h15-16,42H,7-14H2,1-6H3 |
| InChIKey | WBKMMZJWWYRVNS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|