C22H37F3O7S — CID 18721158
1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 18721158) has the molecular formula C22H37F3O7S and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 18721158 |
| Molecular Formula | C22H37F3O7S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-O-[2-hydroxy-3-[(2-methyl-3-oxobutyl)sulfanylmethoxy]propyl] 5-O-(3,3,3-trifluoropropyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COCSCC(C)C(C)=O)C(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C22H37F3O7S/c1-7-21(6,19(29)31-9-8-22(23,24)25)13-20(4,5)18(28)32-11-17(27)10-30-14-33-12-15(2)16(3)26/h15,17,27H,7-14H2,1-6H3 |
| InChIKey | NUJAKNZZMIUPSO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|