C31H39F19O9S — CID 90706361
1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-[4,4,5,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-3-(trifluoromethyl)decyl] 4-ethyl-2,2,4-trimethylpentanedioate;molecular fluorine (PubChem CID 90706361) has the molecular formula C31H39F19O9S and a molecular weight of 948.67 g/mol. Its IUPAC name is 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-[4,4,5,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-3-(trifluoromethyl)decyl] 4-ethyl-2,2,4-trimethylpentanedioate;molecular fluorine.
| Compound Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-[4,4,5,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-3-(trifluoromethyl)decyl] 4-ethyl-2,2,4-trimethylpentanedioate;molecular fluorine |
|---|---|
| PubChem CID | 90706361 |
| Molecular Formula | C31H39F19O9S |
| Molecular Weight | 948.67 g/mol |
| Exact Mass | 948.20 |
| IUPAC Name | 1-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 5-O-[4,4,5,5,6,6,7,7,8,8,9,9,10,10-tetradecafluoro-3-(trifluoromethyl)decyl] 4-ethyl-2,2,4-trimethylpentanedioate;molecular fluorine |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)OC)C(=O)OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.FF |
| InChI | InChI=1S/C31H39F17O9S.F2/c1-7-24(5,14-23(3,4)21(52)57-11-16(49)10-56-18(50)13-58-12-15(2)19(51)54-6)22(53)55-9-8-17(27(38,39)40)25(34,35)28(41,42)30(45,46)31(47,48)29(43,44)26(36,37)20(32)33;1-2/h15-17,20,49H,7-14H2,1-6H3; |
| InChIKey | DVQHWFSZAIEAGD-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 948.67 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|