C29H39F15O9S — CID 91416170
1-O-[4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine (PubChem CID 91416170) has the molecular formula C29H39F15O9S and a molecular weight of 848.66 g/mol. Its IUPAC name is 1-O-[4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine.
| Compound Name | 1-O-[4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine |
|---|---|
| PubChem CID | 91416170 |
| Molecular Formula | C29H39F15O9S |
| Molecular Weight | 848.66 g/mol |
| Exact Mass | 848.21 |
| IUPAC Name | 1-O-[4,4,5,5,6,6,7,7,8,8-decafluoro-3-(trifluoromethyl)octyl] 5-O-[2-hydroxy-3-[2-(3-methoxy-2-methyl-3-oxopropyl)sulfanylacetyl]oxypropyl] 2-ethyl-2,4,4-trimethylpentanedioate;molecular fluorine |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCC(O)COC(=O)CSCC(C)C(=O)OC)C(=O)OCCC(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.FF |
| InChI | InChI=1S/C29H39F13O9S.F2/c1-7-24(5,14-23(3,4)21(46)51-11-16(43)10-50-18(44)13-52-12-15(2)19(45)48-6)22(47)49-9-8-17(27(36,37)38)25(32,33)28(39,40)29(41,42)26(34,35)20(30)31;1-2/h15-17,20,43H,7-14H2,1-6H3; |
| InChIKey | UKIJNLOZPRRONT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|