C29H23N3SSe2Si — CID 140963349
(E)-3-(5-phenoselenazin-10-ylselenophen-2-yl)-2-(6-trimethylsilyl-1,3-benzothiazol-2-yl)prop-2-enenitrile (PubChem CID 140963349) has the molecular formula C29H23N3SSe2Si and a molecular weight of 631.60 g/mol. Its IUPAC name is (E)-3-(5-phenoselenazin-10-ylselenophen-2-yl)-2-(6-trimethylsilyl-1,3-benzothiazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(5-phenoselenazin-10-ylselenophen-2-yl)-2-(6-trimethylsilyl-1,3-benzothiazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 140963349 |
| Molecular Formula | C29H23N3SSe2Si |
| Molecular Weight | 631.60 g/mol |
| Exact Mass | 632.97 |
| IUPAC Name | (E)-3-(5-phenoselenazin-10-ylselenophen-2-yl)-2-(6-trimethylsilyl-1,3-benzothiazol-2-yl)prop-2-enenitrile |
| SMILES | C[Si](C)(C)c1ccc2nc(/C(C#N)=C/c3ccc(N4c5ccccc5[Se]c5ccccc54)[se]3)sc2c1 |
| InChI | InChI=1S/C29H23N3SSe2Si/c1-36(2,3)21-13-14-22-25(17-21)33-29(31-22)19(18-30)16-20-12-15-28(34-20)32-23-8-4-6-10-26(23)35-27-11-7-5-9-24(27)32/h4-17H,1-3H3/b19-16+ |
| InChIKey | FEYKQHCIHAIWGX-KNTRCKAVSA-N |
| XLogP | 5.40 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|