C26H14N4O2SSe2 — CID 140963345
(E)-2-(6-nitro-1,3-benzothiazol-2-yl)-3-(5-phenoselenazin-10-ylselenophen-2-yl)prop-2-enenitrile (PubChem CID 140963345) has the molecular formula C26H14N4O2SSe2 and a molecular weight of 604.41 g/mol. Its IUPAC name is (E)-2-(6-nitro-1,3-benzothiazol-2-yl)-3-(5-phenoselenazin-10-ylselenophen-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(6-nitro-1,3-benzothiazol-2-yl)-3-(5-phenoselenazin-10-ylselenophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 140963345 |
| Molecular Formula | C26H14N4O2SSe2 |
| Molecular Weight | 604.41 g/mol |
| Exact Mass | 605.92 |
| IUPAC Name | (E)-2-(6-nitro-1,3-benzothiazol-2-yl)-3-(5-phenoselenazin-10-ylselenophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(N2c3ccccc3[Se]c3ccccc32)[se]1)c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C26H14N4O2SSe2/c27-15-16(26-28-19-11-9-17(30(31)32)14-22(19)33-26)13-18-10-12-25(34-18)29-20-5-1-3-7-23(20)35-24-8-4-2-6-21(24)29/h1-14H/b16-13+ |
| InChIKey | HBEAIDZZDMXIRY-DTQAZKPQSA-N |
| XLogP | 4.76 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|