C28H21N3SSeSi — CID 140963320
(E)-2-(1,3-benzothiazol-2-yl)-3-[5-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)selenophen-2-yl]prop-2-enenitrile (PubChem CID 140963320) has the molecular formula C28H21N3SSeSi and a molecular weight of 538.61 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-[5-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)selenophen-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[5-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)selenophen-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 140963320 |
| Molecular Formula | C28H21N3SSeSi |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[5-(10,10-dimethylbenzo[b][1,4]benzazasilin-5-yl)selenophen-2-yl]prop-2-enenitrile |
| SMILES | C[Si]1(C)c2ccccc2N(c2ccc(/C=C(\C#N)c3nc4ccccc4s3)[se]2)c2ccccc21 |
| InChI | InChI=1S/C28H21N3SSeSi/c1-34(2)25-13-7-4-10-22(25)31(23-11-5-8-14-26(23)34)27-16-15-20(33-27)17-19(18-29)28-30-21-9-3-6-12-24(21)32-28/h3-17H,1-2H3/b19-17+ |
| InChIKey | ACGWQUCGUKIVMC-HTXNQAPBSA-N |
| XLogP | 6.02 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|