C9H12F6O3 — CID 140970451
1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoxyethoxymethyl)propan-2-ol (PubChem CID 140970451) has the molecular formula C9H12F6O3 and a molecular weight of 282.18 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoxyethoxymethyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoxyethoxymethyl)propan-2-ol |
|---|---|
| PubChem CID | 140970451 |
| Molecular Formula | C9H12F6O3 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2-prop-2-enoxyethoxymethyl)propan-2-ol |
| SMILES | C=CCOCCOCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6O3/c1-2-3-17-4-5-18-6-7(16,8(10,11)12)9(13,14)15/h2,16H,1,3-6H2 |
| InChIKey | DZLNJLJKGWWOBI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|