C12H12N2O3S — CID 140971697
2-oxo-2-(4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)acetic acid (PubChem CID 140971697) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-oxo-2-(4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)acetic acid.
| Compound Name | 2-oxo-2-(4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)acetic acid |
|---|---|
| PubChem CID | 140971697 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-oxo-2-(4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-yl)acetic acid |
| SMILES | O=C(O)C(=O)C1CSc2cccc3c2N1CCN3 |
| InChI | InChI=1S/C12H12N2O3S/c15-11(12(16)17)8-6-18-9-3-1-2-7-10(9)14(8)5-4-13-7/h1-3,8,13H,4-6H2,(H,16,17) |
| InChIKey | VYPFSGZWBVKNOT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|