C12H11N3OS — CID 140971701
4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2-carbonyl cyanide (PubChem CID 140971701) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2-carbonyl cyanide.
| Compound Name | 4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2-carbonyl cyanide |
|---|---|
| PubChem CID | 140971701 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-thia-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-2-carbonyl cyanide |
| SMILES | N#CC(=O)C1CSc2cccc3c2N1CCN3 |
| InChI | InChI=1S/C12H11N3OS/c13-6-10(16)9-7-17-11-3-1-2-8-12(11)15(9)5-4-14-8/h1-3,9,14H,4-5,7H2 |
| InChIKey | CLVSRCUPKNKXQV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|