C12H6Na3O24P — CID 140971891
trisodium;2-dioxalooxyphosphanyloxy-2-oxoacetic acid;tris(2-hydroxy-2-oxoacetate) (PubChem CID 140971891) has the molecular formula C12H6Na3O24P and a molecular weight of 634.10 g/mol. Its IUPAC name is trisodium;2-dioxalooxyphosphanyloxy-2-oxoacetic acid;tris(2-hydroxy-2-oxoacetate).
| Compound Name | trisodium;2-dioxalooxyphosphanyloxy-2-oxoacetic acid;tris(2-hydroxy-2-oxoacetate) |
|---|---|
| PubChem CID | 140971891 |
| Molecular Formula | C12H6Na3O24P |
| Molecular Weight | 634.10 g/mol |
| Exact Mass | 633.87 |
| IUPAC Name | trisodium;2-dioxalooxyphosphanyloxy-2-oxoacetic acid;tris(2-hydroxy-2-oxoacetate) |
| SMILES | O=C(O)C(=O)OP(OC(=O)C(=O)O)OC(=O)C(=O)O.O=C([O-])C(=O)O.O=C([O-])C(=O)O.O=C([O-])C(=O)O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H3O12P.3C2H2O4.3Na/c7-1(8)4(13)16-19(17-5(14)2(9)10)18-6(15)3(11)12;3*3-1(4)2(5)6;;;/h(H,7,8)(H,9,10)(H,11,12);3*(H,3,4)(H,5,6);;;/q;;;;3*+1/p-3 |
| InChIKey | MKPCSOQBNAZUHZ-UHFFFAOYSA-K |
| XLogP | -17.43 |
| TPSA | 423.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.10 |
| LogP ≤ 5 | -17.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|