C17H21N3O3S2 — CID 140992281
prop-2-enyl 2-acetylsulfanyl-5-[(3-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 140992281) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is prop-2-enyl 2-acetylsulfanyl-5-[(3-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 2-acetylsulfanyl-5-[(3-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140992281 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | prop-2-enyl 2-acetylsulfanyl-5-[(3-methylimidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C(Cc2sc3cncn3c2C)CCC1SC(C)=O |
| InChI | InChI=1S/C17H21N3O3S2/c1-4-7-23-17(22)20-13(5-6-15(20)24-12(3)21)8-14-11(2)19-10-18-9-16(19)25-14/h4,9-10,13,15H,1,5-8H2,2-3H3 |
| InChIKey | NMZLFWCVLWTJBC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|