C20H31N3O4SSi — CID 173280935
prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy(imidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 173280935) has the molecular formula C20H31N3O4SSi and a molecular weight of 437.64 g/mol. Its IUPAC name is prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy(imidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy(imidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173280935 |
| Molecular Formula | C20H31N3O4SSi |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | prop-2-enyl (3R,5S)-3-tert-butyl-2-dimethylsilyloxy-5-[hydroxy(imidazo[5,1-b][1,3]thiazol-2-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C(O[SiH](C)C)[C@@H](C(C)(C)C)C[C@H]1C(O)c1cn2cncc2s1 |
| InChI | InChI=1S/C20H31N3O4SSi/c1-7-8-26-19(25)23-14(9-13(20(2,3)4)18(23)27-29(5)6)17(24)15-11-22-12-21-10-16(22)28-15/h7,10-14,17-18,24,29H,1,8-9H2,2-6H3/t13-,14-,17?,18?/m0/s1 |
| InChIKey | SFTFHFSXEIKMTD-DIOPXHOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|