C20H28O2 — CID 140995854
1-(2,4-ditert-butyl-3-hydroxyphenyl)hex-2-yn-1-one (PubChem CID 140995854) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-(2,4-ditert-butyl-3-hydroxyphenyl)hex-2-yn-1-one.
| Compound Name | 1-(2,4-ditert-butyl-3-hydroxyphenyl)hex-2-yn-1-one |
|---|---|
| PubChem CID | 140995854 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1-(2,4-ditert-butyl-3-hydroxyphenyl)hex-2-yn-1-one |
| SMILES | CCCC#CC(=O)c1ccc(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C20H28O2/c1-8-9-10-11-16(21)14-12-13-15(19(2,3)4)18(22)17(14)20(5,6)7/h12-13,22H,8-9H2,1-7H3 |
| InChIKey | KUBSDVURERYACH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|