C15H17NO4 — CID 140999756
(1-ethyl-2,5-dioxopyrrol-3-yl) bicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 140999756) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (1-ethyl-2,5-dioxopyrrol-3-yl) bicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | (1-ethyl-2,5-dioxopyrrol-3-yl) bicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 140999756 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (1-ethyl-2,5-dioxopyrrol-3-yl) bicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CCN1C(=O)C=C(OC(=O)C2CC3C=CC2CC3)C1=O |
| InChI | InChI=1S/C15H17NO4/c1-2-16-13(17)8-12(14(16)18)20-15(19)11-7-9-3-5-10(11)6-4-9/h3,5,8-11H,2,4,6-7H2,1H3 |
| InChIKey | ITPAHVONQHRXQP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|