C9H14O5Si — CID 141002779
(ethyl-hydroxy-prop-2-enoyloxysilyl) 2-methylprop-2-enoate (PubChem CID 141002779) has the molecular formula C9H14O5Si and a molecular weight of 230.29 g/mol. Its IUPAC name is (ethyl-hydroxy-prop-2-enoyloxysilyl) 2-methylprop-2-enoate.
| Compound Name | (ethyl-hydroxy-prop-2-enoyloxysilyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141002779 |
| Molecular Formula | C9H14O5Si |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (ethyl-hydroxy-prop-2-enoyloxysilyl) 2-methylprop-2-enoate |
| SMILES | C=CC(=O)O[Si](O)(CC)OC(=O)C(=C)C |
| InChI | InChI=1S/C9H14O5Si/c1-5-8(10)13-15(12,6-2)14-9(11)7(3)4/h5,12H,1,3,6H2,2,4H3 |
| InChIKey | LHOMLTJVSUVGRJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|