C10H7Cl5 — CID 141014892
2,3,4,4,4-pentachlorobut-2-enylbenzene (PubChem CID 141014892) has the molecular formula C10H7Cl5 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2,3,4,4,4-pentachlorobut-2-enylbenzene.
| Compound Name | 2,3,4,4,4-pentachlorobut-2-enylbenzene |
|---|---|
| PubChem CID | 141014892 |
| Molecular Formula | C10H7Cl5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 301.90 |
| IUPAC Name | 2,3,4,4,4-pentachlorobut-2-enylbenzene |
| SMILES | ClC(Cc1ccccc1)=C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H7Cl5/c11-8(9(12)10(13,14)15)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | TXJOOGSFXUNRHY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|