C21H36O4 — CID 141021320
1,1-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 141021320) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1,1-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | 1,1-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 141021320 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 1,1-dihydroxypropyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(O)(O)CC |
| InChI | InChI=1S/C21H36O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(22)25-21(23,24)4-2/h5-6,8-9,11-12,23-24H,3-4,7,10,13-19H2,1-2H3/b6-5-,9-8-,12-11- |
| InChIKey | ZIQMWPPFGKUAAG-AGRJPVHOSA-N |
| XLogP | 5.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|