C23H30O — CID 141021383
2,3,6,7-tetraethyl-1-(methoxymethyl)-9H-fluorene (PubChem CID 141021383) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is 2,3,6,7-tetraethyl-1-(methoxymethyl)-9H-fluorene.
| Compound Name | 2,3,6,7-tetraethyl-1-(methoxymethyl)-9H-fluorene |
|---|---|
| PubChem CID | 141021383 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2,3,6,7-tetraethyl-1-(methoxymethyl)-9H-fluorene |
| SMILES | CCc1cc2c(cc1CC)-c1cc(CC)c(CC)c(COC)c1C2 |
| InChI | InChI=1S/C23H30O/c1-6-15-10-18-13-22-21(20(18)11-16(15)7-2)12-17(8-3)19(9-4)23(22)14-24-5/h10-12H,6-9,13-14H2,1-5H3 |
| InChIKey | KMVKBCJJXJODFX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |