C14H17ClLiO3P — CID 141023125
lithium (3-chloro-2,6-dimethoxybenzoyl)-cyclopentylphosphanide (PubChem CID 141023125) has the molecular formula C14H17ClLiO3P and a molecular weight of 306.65 g/mol. Its IUPAC name is lithium (3-chloro-2,6-dimethoxybenzoyl)-cyclopentylphosphanide.
| Compound Name | lithium (3-chloro-2,6-dimethoxybenzoyl)-cyclopentylphosphanide |
|---|---|
| PubChem CID | 141023125 |
| Molecular Formula | C14H17ClLiO3P |
| Molecular Weight | 306.65 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | lithium (3-chloro-2,6-dimethoxybenzoyl)-cyclopentylphosphanide |
| SMILES | COc1ccc(Cl)c(OC)c1C(=O)[P-]C1CCCC1.[Li+] |
| InChI | InChI=1S/C14H17ClO3P.Li/c1-17-11-8-7-10(15)13(18-2)12(11)14(16)19-9-5-3-4-6-9;/h7-9H,3-6H2,1-2H3;/q-1;+1 |
| InChIKey | AZROECVDFAMVNR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.65 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|