C22H20FN3O4S2 — CID 141023446
1-[[4-[(2-fluorobenzoyl)amino]phenyl]carbamothioylamino]-2-phenylethanesulfonic acid (PubChem CID 141023446) has the molecular formula C22H20FN3O4S2 and a molecular weight of 473.55 g/mol. Its IUPAC name is 1-[[4-[(2-fluorobenzoyl)amino]phenyl]carbamothioylamino]-2-phenylethanesulfonic acid.
| Compound Name | 1-[[4-[(2-fluorobenzoyl)amino]phenyl]carbamothioylamino]-2-phenylethanesulfonic acid |
|---|---|
| PubChem CID | 141023446 |
| Molecular Formula | C22H20FN3O4S2 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 1-[[4-[(2-fluorobenzoyl)amino]phenyl]carbamothioylamino]-2-phenylethanesulfonic acid |
| SMILES | O=C(Nc1ccc(NC(=S)NC(Cc2ccccc2)S(=O)(=O)O)cc1)c1ccccc1F |
| InChI | InChI=1S/C22H20FN3O4S2/c23-19-9-5-4-8-18(19)21(27)24-16-10-12-17(13-11-16)25-22(31)26-20(32(28,29)30)14-15-6-2-1-3-7-15/h1-13,20H,14H2,(H,24,27)(H2,25,26,31)(H,28,29,30) |
| InChIKey | IYJKTXRWIUEBLH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|