C16H32Cl2N4 — CID 141024509
15,16-dichloro-4,11,15,16-tetramethyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane (PubChem CID 141024509) has the molecular formula C16H32Cl2N4 and a molecular weight of 351.37 g/mol. Its IUPAC name is 15,16-dichloro-4,11,15,16-tetramethyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane.
| Compound Name | 15,16-dichloro-4,11,15,16-tetramethyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
|---|---|
| PubChem CID | 141024509 |
| Molecular Formula | C16H32Cl2N4 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 15,16-dichloro-4,11,15,16-tetramethyl-1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
| SMILES | CN1CCCN2CCN(C)CCCN(CC1)C(C)(Cl)C2(C)Cl |
| InChI | InChI=1S/C16H32Cl2N4/c1-15(17)16(2,18)22-10-6-8-19(3)11-13-21(15)9-5-7-20(4)12-14-22/h5-14H2,1-4H3 |
| InChIKey | PYKIMVOGUZGPJV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|